Products 107647-14-3
CAS 107647-14-3 appears in our catalog under these names: Sterebin A, Sterebin A - Stevia rebaudiana, Sterebin A, ≥98%. Offered by: TRC, TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 5 mg, 10 mg, 1 mg.
(E)-4-[(1R,2S,3S,4R,4aS,8aS)-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]but-3-en-2-one (CAS 107647-14-3) is a chemical compound with the molecular formula C18H30O4 and a molecular weight of 310.4 g/mol. IUPAC name: (E)-4-[(1R,2S,3S,4R,4aS,8aS)-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]but-3-en-2-one. InChIKey: GUVJPXABQYFWPD-JOSLJWRDSA-N.
| Molecular formula | C18H30O4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (E)-4-[(1R,2S,3S,4R,4aS,8aS)-2,3,4-trihydroxy-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]but-3-en-2-one |
| InChIKey | GUVJPXABQYFWPD-JOSLJWRDSA-N |
| SMILES | CC(=O)/C=C/[C@@H]1[C@]2(CCCC([C@@H]2[C@H]([C@@H]([C@@]1(C)O)O)O)(C)C)C |
Computed by PubChem (NCBI)