Products 6701-13-9
CAS 6701-13-9 appears in our catalog under these names: 1,10-Decamethylene glycol dimethacrylate, 97%, Decane-1,10-diyl bis(2-methylacrylate) 97%, 1,10-DECANEDIOL DIMETHACRYLATE, Decane-1,10-diyl bis(2-methylacrylate), 97%, 97%, Decane-1,10-diyl bis(2-methylacrylate), 98%. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich, Chemat, HPC Standards. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 1x10mg.
10-(2-methylprop-2-enoyloxy)decyl 2-methylprop-2-enoate (CAS 6701-13-9) is a chemical compound with the molecular formula C18H30O4 and a molecular weight of 310.4 g/mol. IUPAC name: 10-(2-methylprop-2-enoyloxy)decyl 2-methylprop-2-enoate. InChIKey: LRZPQLZONWIQOJ-UHFFFAOYSA-N.
| Molecular formula | C18H30O4 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 10-(2-methylprop-2-enoyloxy)decyl 2-methylprop-2-enoate |
| InChIKey | LRZPQLZONWIQOJ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCCCCCCCCOC(=O)C(=C)C |
Computed by PubChem (NCBI)
Synonyms:
1,10-Decanediol dimethacrylate, 1,10-Decamethylene glycol dimethacrylate, 1,10-decamethylene dimethacrylate, 1,10-Decanediyl bismethacrylate, NK ESTER DOD-N, 2-Propenoic acid, 2-methyl-, 1,10-decanediyl ester, DECAMETHYLENE METHACRYLATE, 2-Propenoic acid, 2-methyl-, 1,1'-(1,10-decanediyl) ester, DECAMETHYLENE DIMETHACRYLATE, DECAMETHYLENE GLYCOL DIMETHACRYLATE