Products 121107-97-9

CAS 121107-97-9 appears in our catalog under these names: 13(S)-HpOTrE(γ), 13(S)–HpOTrE(γ), 13(S)-HPOTrE(γ), 99.9%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 100ug, 500ug, 1mg, 100μg, 5mg, 500μg, 100 μg (3.22 mM * 100 μL in Ethanol).

Structural formula: {0} (CAS {1})

(6Z,9Z,11E,13S)-13-hydroperoxyoctadeca-6,9,11-trienoic acid (CAS 121107-97-9) is a chemical compound with the molecular formula C18H30O4 and a molecular weight of 310.4 g/mol. IUPAC name: (6Z,9Z,11E,13S)-13-hydroperoxyoctadeca-6,9,11-trienoic acid. InChIKey: LYFGXCQTRBQQMX-KYLWABQHSA-N.

Identity
Molecular formulaC18H30O4
Molecular weight310.4 g/mol
IUPAC name(6Z,9Z,11E,13S)-13-hydroperoxyoctadeca-6,9,11-trienoic acid
InChIKeyLYFGXCQTRBQQMX-KYLWABQHSA-N
SMILESCCCCC[C@@H](/C=C/C=C\C/C=C\CCCCC(=O)O)OO

Computed by PubChem (NCBI)