Products 1077-58-3
CAS 1077-58-3 appears in our catalog under these names: 2-tert-Butylbenzoic acid, 98%, 2-tert-Butylbenzoic Acid, >95% (HPLC), 2–tert–butylbenzoic acid, 2-(tert-Butyl)benzoic acid 95%, 2-(tert-Butyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg, 500mg, 10g.
2-tert-butylbenzoic acid (CAS 1077-58-3) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-tert-butylbenzoic acid. InChIKey: ZDFKSZDMHJHQHS-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-tert-butylbenzoic acid |
| InChIKey | ZDFKSZDMHJHQHS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(tert-Butyl)benzoic acid, tert-Butylbenzoic acid, Benzoic acid, (1,1-dimethylethyl)-, Benzoic acid, tert-butyl-, 2-tert-Butylbenzoic acid, o-tert-butylbenzoic acid, 2-(1,1-dimethylethyl)benzoic acid, Benzoic acid, 2-(1,1-dimethylethyl)-, 2-(1,1-Dimethylethyl)benzoic Acid; NSC 86592; o-tert-Butylbenzoic Acid, t-butylbenzoic acid