Products 107777-22-0
CAS 107777-22-0 appears in our catalog under these names: 4-Propyl-1-naphthoic acid, 95%, 4–Propyl–1–naphthoic acid, 4-Propyl-1-naphthoic acid, 4-Propyl-1-naphthoic acid, 99%+(LC-MS),RG, 99%+(LC-MS),RG, 4-Propyl-1-naphthoic acid, 99%+(LC-MS),RG. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
4-propylnaphthalene-1-carboxylic acid (CAS 107777-22-0) is a chemical compound with the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. IUPAC name: 4-propylnaphthalene-1-carboxylic acid. InChIKey: JCRVNKIHIKWKKC-UHFFFAOYSA-N.
| Molecular formula | C14H14O2 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 4-propylnaphthalene-1-carboxylic acid |
| InChIKey | JCRVNKIHIKWKKC-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C2=CC=CC=C12)C(=O)O |
Computed by PubChem (NCBI)