Products 107783-46-0
CAS 107783-46-0 appears in our catalog under these names: Henricin, Henricine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
5-[(2S,3R,4S,5S)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]-1,3-benzodioxole (CAS 107783-46-0) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: 5-[(2S,3R,4S,5S)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]-1,3-benzodioxole. InChIKey: WHNJCTMEGTVMBR-KNRKYQCFSA-N.
| Molecular formula | C22H26O6 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 5-[(2S,3R,4S,5S)-3,4-dimethyl-5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]-1,3-benzodioxole |
| InChIKey | WHNJCTMEGTVMBR-KNRKYQCFSA-N |
| SMILES | C[C@@H]1[C@@H]([C@H](O[C@@H]1C2=CC3=C(C=C2)OCO3)C4=CC(=C(C(=C4)OC)OC)OC)C |
Computed by PubChem (NCBI)