Products 4440-92-0

CAS 4440-92-0 is the registry number for DBB–0920. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 200mg, 2g, 50mg, 500mg.

Structural formula: {0} (CAS {1})

1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione (CAS 4440-92-0) is a chemical compound with the molecular formula C22H26O6 and a molecular weight of 386.4 g/mol. IUPAC name: 1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione. InChIKey: SPBNPRXRUYBFDV-UHFFFAOYSA-N.

Identity
Molecular formulaC22H26O6
Molecular weight386.4 g/mol
IUPAC name1,4-bis(3,4-dimethoxyphenyl)-2,3-dimethylbutane-1,4-dione
InChIKeySPBNPRXRUYBFDV-UHFFFAOYSA-N
SMILESCC(C(C)C(=O)C1=CC(=C(C=C1)OC)OC)C(=O)C2=CC(=C(C=C2)OC)OC

Computed by PubChem (NCBI)