CAS 1078162-97-6 is the registry number for N-Phenyl-1,3-thiazolidine-4-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
N-phenyl-1,3-thiazolidine-4-carboxamide;hydrochloride (CAS 1078162-97-6) is a chemical compound with the molecular formula C10H13ClN2OS and a molecular weight of 244.74 g/mol. IUPAC name: N-phenyl-1,3-thiazolidine-4-carboxamide;hydrochloride. InChIKey: QXVLUWOKVDADLG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2OS |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | N-phenyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| InChIKey | QXVLUWOKVDADLG-UHFFFAOYSA-N |
| SMILES | C1C(NCS1)C(=O)NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)