CAS 650592-73-7 is the registry number for 2-Chloro-n-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (CAS 650592-73-7) is a chemical compound with the molecular formula C10H13ClN2OS and a molecular weight of 244.74 g/mol. IUPAC name: 2-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide. InChIKey: AJCKEQISKDYDRN-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2OS |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | 2-chloro-N-(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| InChIKey | AJCKEQISKDYDRN-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)SC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)