CAS 1269050-29-4 appears in our catalog under these names: 2-[(1H-Benzimidazol-2-ylmethyl)thio]ethanol hydrochloride, 95%, 2-((1H-Benzimidazol-2-ylmethyl)thio)ethanol hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2-(1H-benzimidazol-2-ylmethylsulfanyl)ethanol;hydrochloride (CAS 1269050-29-4) is a chemical compound with the molecular formula C10H13ClN2OS and a molecular weight of 244.74 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylmethylsulfanyl)ethanol;hydrochloride. InChIKey: XJTMSGASMITMSA-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2OS |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)ethanol;hydrochloride |
| InChIKey | XJTMSGASMITMSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CSCCO.Cl |
Computed by PubChem (NCBI)