CAS 1078712-00-1 is the registry number for 2-(Pyrimidin-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-pyrimidin-5-ylbenzoic acid (CAS 1078712-00-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-pyrimidin-5-ylbenzoic acid. InChIKey: OLFSCYMDVCTSRL-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-pyrimidin-5-ylbenzoic acid |
| InChIKey | OLFSCYMDVCTSRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CN=CN=C2)C(=O)O |
Computed by PubChem (NCBI)