Products 1078712-00-1

CAS 1078712-00-1 is the registry number for 2-(Pyrimidin-5-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-pyrimidin-5-ylbenzoic acid (CAS 1078712-00-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-pyrimidin-5-ylbenzoic acid. InChIKey: OLFSCYMDVCTSRL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8N2O2
Molecular weight200.19 g/mol
IUPAC name2-pyrimidin-5-ylbenzoic acid
InChIKeyOLFSCYMDVCTSRL-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CN=CN=C2)C(=O)O

Computed by PubChem (NCBI)