CAS 1079-95-4 is the registry number for 3,5-Diacetyl-1,4-dihydro-2,6-lutidine. Offered by: Dr. Ehrenstorfer. Available pack sizes: 100mg.
1-(5-acetyl-2,6-dimethyl-1,4-dihydropyridin-3-yl)ethanone (CAS 1079-95-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 1-(5-acetyl-2,6-dimethyl-1,4-dihydropyridin-3-yl)ethanone. InChIKey: SLZAMKNXRDJWLA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 1-(5-acetyl-2,6-dimethyl-1,4-dihydropyridin-3-yl)ethanone |
| InChIKey | SLZAMKNXRDJWLA-UHFFFAOYSA-N |
| SMILES | CC1=C(CC(=C(N1)C)C(=O)C)C(=O)C |
Computed by PubChem (NCBI)