CAS 107920-32-1 is the registry number for 4-Isothiocyanato-n-(2-methoxyphenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-isothiocyanato-N-(2-methoxyphenyl)benzenesulfonamide (CAS 107920-32-1) is a chemical compound with the molecular formula C14H12N2O3S2 and a molecular weight of 320.4 g/mol. IUPAC name: 4-isothiocyanato-N-(2-methoxyphenyl)benzenesulfonamide. InChIKey: UHVSRNDEYIWVSA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-isothiocyanato-N-(2-methoxyphenyl)benzenesulfonamide |
| InChIKey | UHVSRNDEYIWVSA-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NS(=O)(=O)C2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)