Products 178675-17-7

CAS 178675-17-7 is the registry number for Methyl 3-(((phenylcarbonylamino)thioxomethyl)amino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate (CAS 178675-17-7) is a chemical compound with the molecular formula C14H12N2O3S2 and a molecular weight of 320.4 g/mol. IUPAC name: methyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate. InChIKey: PCHMYYLDEPUVQL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12N2O3S2
Molecular weight320.4 g/mol
IUPAC namemethyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate
InChIKeyPCHMYYLDEPUVQL-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=CS1)NC(=S)NC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)