CAS 178675-17-7 is the registry number for Methyl 3-(((phenylcarbonylamino)thioxomethyl)amino)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g.
Methyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate (CAS 178675-17-7) is a chemical compound with the molecular formula C14H12N2O3S2 and a molecular weight of 320.4 g/mol. IUPAC name: methyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate. InChIKey: PCHMYYLDEPUVQL-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | methyl 3-(benzoylcarbamothioylamino)thiophene-2-carboxylate |
| InChIKey | PCHMYYLDEPUVQL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CS1)NC(=S)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)