CAS 130-17-6 is the registry number for 2-(4-Aminophenyl)-6-methylbenzothiazole-7-sulphonic acid. Offered by: Chemat. Available pack sizes: 100g, 10g.
2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid (CAS 130-17-6) is a chemical compound with the molecular formula C14H12N2O3S2 and a molecular weight of 320.4 g/mol. IUPAC name: 2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid. InChIKey: KGZUHYIHYBDNLC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3S2 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 2-(4-aminophenyl)-6-methyl-1,3-benzothiazole-7-sulfonic acid |
| InChIKey | KGZUHYIHYBDNLC-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=C(S2)C3=CC=C(C=C3)N)S(=O)(=O)O |
Computed by PubChem (NCBI)