Products 350989-62-7
CAS 350989-62-7 appears in our catalog under these names: 2-(3-Ethoxyphenyl)quinoline-4-carboxylic acid, 95%, 2-(3-Ethoxyphenyl)quinoline-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
2-(3-ethoxyphenyl)quinoline-4-carboxylic acid (CAS 350989-62-7) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: 2-(3-ethoxyphenyl)quinoline-4-carboxylic acid. InChIKey: FYNXBOGQOPBGMF-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | 2-(3-ethoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | FYNXBOGQOPBGMF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)