Products 1080008-87-2
CAS 1080008-87-2 is the registry number for BLX-2477. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2,4-dichlorophenyl)-2H-triazole-4-carboxamide (CAS 1080008-87-2) is a chemical compound with the molecular formula C9H6Cl2N4O and a molecular weight of 257.07 g/mol. IUPAC name: N-(2,4-dichlorophenyl)-2H-triazole-4-carboxamide. InChIKey: GAGGCNZJYKWGJL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N4O |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)-2H-triazole-4-carboxamide |
| InChIKey | GAGGCNZJYKWGJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=O)C2=NNN=C2 |
Computed by PubChem (NCBI)