CAS 1080496-42-9 appears in our catalog under these names: (S)-2-Amino-3-(4-(prop-2-yn-1-yl)phenyl)propanoic acid, 97%, 4–Propargyloxy–L–phenylalanine, 4-Propargyloxy-L-phenylalanine, (S)-2-Amino-3-(4-(prop-2-yn-1-yl)phenyl)propanoic acid. Offered by: AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 1000mg, 500mg.
(2S)-2-amino-3-(4-prop-2-ynylphenyl)propanoic acid (CAS 1080496-42-9) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: (2S)-2-amino-3-(4-prop-2-ynylphenyl)propanoic acid. InChIKey: BJOQKIKXKGJLIJ-NSHDSACASA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-prop-2-ynylphenyl)propanoic acid |
| InChIKey | BJOQKIKXKGJLIJ-NSHDSACASA-N |
| SMILES | C#CCC1=CC=C(C=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)