Products 1080650-03-8
CAS 1080650-03-8 appears in our catalog under these names: 2-Chloro-4,6-dimethyl-5-nitropyrimidine 95%, 2-Chloro-4,6-dimethyl-5-nitropyrimidine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-chloro-4,6-dimethyl-5-nitropyrimidine (CAS 1080650-03-8) is a chemical compound with the molecular formula C6H6ClN3O2 and a molecular weight of 187.58 g/mol. IUPAC name: 2-chloro-4,6-dimethyl-5-nitropyrimidine. InChIKey: MRUDNQYMHIHIEA-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O2 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 2-chloro-4,6-dimethyl-5-nitropyrimidine |
| InChIKey | MRUDNQYMHIHIEA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)Cl)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)