Products 1081548-91-5
CAS 1081548-91-5 appears in our catalog under these names: (1R,2R)-2-(Methylamino)-1,2-diphenylethanol, 95%, (1R，2R)–2–(Methylamino)–1，2–diphenylethanol, (1R,2R)-2-(Methylamino)-1,2-diphenylethanol, (1R,2R)-2-(Methylamino)-1,2-diphenylethanol, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1R,2R)-2-(methylamino)-1,2-diphenylethanol (CAS 1081548-91-5) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (1R,2R)-2-(methylamino)-1,2-diphenylethanol. InChIKey: BLDFSDCBQJUWFG-HUUCEWRRSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (1R,2R)-2-(methylamino)-1,2-diphenylethanol |
| InChIKey | BLDFSDCBQJUWFG-HUUCEWRRSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1)[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)