Products 1082399-74-3
CAS 1082399-74-3 appears in our catalog under these names: 1-(Aminomethyl)-6-fluoro-2,3-dihydro-1h-inden-1-ol, 95%, 1-(Aminomethyl)-6-fluoro-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 0,5g, 50mg.
1-(aminomethyl)-6-fluoro-2,3-dihydroinden-1-ol (CAS 1082399-74-3) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 1-(aminomethyl)-6-fluoro-2,3-dihydroinden-1-ol. InChIKey: XVKDJDCBVTYRIC-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 1-(aminomethyl)-6-fluoro-2,3-dihydroinden-1-ol |
| InChIKey | XVKDJDCBVTYRIC-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=CC(=C2)F)(CN)O |
Computed by PubChem (NCBI)