CAS 930599-55-6 appears in our catalog under these names: N-(3-Fluoro-4,5-dimethylphenyl)-acetamide, 95%, N-(3-Fluoro-4,5-dimethylphenyl)-acetamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
N-(3-fluoro-4,5-dimethylphenyl)acetamide (CAS 930599-55-6) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: N-(3-fluoro-4,5-dimethylphenyl)acetamide. InChIKey: MGLQOISALXIQCC-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | N-(3-fluoro-4,5-dimethylphenyl)acetamide |
| InChIKey | MGLQOISALXIQCC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)F)NC(=O)C |
Computed by PubChem (NCBI)