CAS 459218-95-2 appears in our catalog under these names: N-Isopropyl 3-fluorobenzamide, 95%, 3-Fluoro-N-isopropylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
3-fluoro-N-propan-2-ylbenzamide (CAS 459218-95-2) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 3-fluoro-N-propan-2-ylbenzamide. InChIKey: ZNFBPSJICUZBIX-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 3-fluoro-N-propan-2-ylbenzamide |
| InChIKey | ZNFBPSJICUZBIX-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=CC=C1)F |
Computed by PubChem (NCBI)