CAS 1082458-56-7 appears in our catalog under these names: 2–(3,4–dimethylphenyl)propan–2–amine hydrochloride, 2-(3,4-dimethylphenyl)propan-2-amine. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-(3,4-dimethylphenyl)propan-2-amine (CAS 1082458-56-7) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)propan-2-amine. InChIKey: VAWYJSXOMSOACH-UHFFFAOYSA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)propan-2-amine |
| InChIKey | VAWYJSXOMSOACH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C)N)C |
Computed by PubChem (NCBI)