Products 1082468-18-5

CAS 1082468-18-5 is the registry number for 2-((2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)thio)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propanoic acid (CAS 1082468-18-5) is a chemical compound with the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propanoic acid. InChIKey: ZOUQEZRWVQATMA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4S
Molecular weight240.28 g/mol
IUPAC name2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)propanoic acid
InChIKeyZOUQEZRWVQATMA-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=CC2=C(C=C1)OCCO2

Computed by PubChem (NCBI)