CAS 24090-18-4 appears in our catalog under these names: 4,7-Dioxo-7-thiophen-2-yl-heptanoic acid, 95%, 4,7-Dioxo-7-thiophen-2-yl-heptanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
4,7-dioxo-7-thiophen-2-ylheptanoic acid (CAS 24090-18-4) is a chemical compound with the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. IUPAC name: 4,7-dioxo-7-thiophen-2-ylheptanoic acid. InChIKey: YVUGOXHLJJWQFP-UHFFFAOYSA-N.
| Molecular formula | C11H12O4S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 4,7-dioxo-7-thiophen-2-ylheptanoic acid |
| InChIKey | YVUGOXHLJJWQFP-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)CCC(=O)CCC(=O)O |
Computed by PubChem (NCBI)