CAS 38131-57-6 is the registry number for Methyl 2-((phenylsulfonyl)methyl)acrylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Methyl 2-(benzenesulfonylmethyl)prop-2-enoate (CAS 38131-57-6) is a chemical compound with the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. IUPAC name: methyl 2-(benzenesulfonylmethyl)prop-2-enoate. InChIKey: IURXGXXNHGHUDV-UHFFFAOYSA-N.
| Molecular formula | C11H12O4S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | methyl 2-(benzenesulfonylmethyl)prop-2-enoate |
| InChIKey | IURXGXXNHGHUDV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C)CS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)