CAS 1082558-21-1 appears in our catalog under these names: 2-​Cyclopropyl-​2,​3-​dihydro-​3-​oxo-1,​2-​benzisothiazole-​6-​carboxylic acid 1,​1-​dioxide, 2-Cyclopropyl-1,1,3-trioxo-2,3-dihydro-1,2-benzothiazole-6-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid (CAS 1082558-21-1) is a chemical compound with the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. IUPAC name: 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid. InChIKey: HCWXRWFYAUPEBF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5S |
|---|---|
| Molecular weight | 267.26 g/mol |
| IUPAC name | 2-cyclopropyl-1,1,3-trioxo-1,2-benzothiazole-6-carboxylic acid |
| InChIKey | HCWXRWFYAUPEBF-UHFFFAOYSA-N |
| SMILES | C1CC1N2C(=O)C3=C(S2(=O)=O)C=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)