Products 1082821-82-6

CAS 1082821-82-6 is the registry number for 5-(4-(Methylsulfonyl)phenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxylic acid (CAS 1082821-82-6) is a chemical compound with the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. IUPAC name: 5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: DRJMISNHZOQZMF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO5S
Molecular weight267.26 g/mol
IUPAC name5-(4-methylsulfonylphenyl)-1,2-oxazole-3-carboxylic acid
InChIKeyDRJMISNHZOQZMF-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)C2=CC(=NO2)C(=O)O

Computed by PubChem (NCBI)