Products 773869-38-8
CAS 773869-38-8 is the registry number for Mab-SaS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3-sulfamoylphenyl)furan-2-carboxylic acid (CAS 773869-38-8) is a chemical compound with the molecular formula C11H9NO5S and a molecular weight of 267.26 g/mol. IUPAC name: 5-(3-sulfamoylphenyl)furan-2-carboxylic acid. InChIKey: GPOLQEMETAGELB-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5S |
|---|---|
| Molecular weight | 267.26 g/mol |
| IUPAC name | 5-(3-sulfamoylphenyl)furan-2-carboxylic acid |
| InChIKey | GPOLQEMETAGELB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)