CAS 1082565-35-2 is the registry number for 5-Fluoro-3-phenylbenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-fluoro-5-phenylbenzoic acid (CAS 1082565-35-2) is a chemical compound with the molecular formula C13H9FO2 and a molecular weight of 216.21 g/mol. IUPAC name: 3-fluoro-5-phenylbenzoic acid. InChIKey: CMQRNIJBMDZLEU-UHFFFAOYSA-N.
| Molecular formula | C13H9FO2 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | 3-fluoro-5-phenylbenzoic acid |
| InChIKey | CMQRNIJBMDZLEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)