CAS 108260-07-7 appears in our catalog under these names: (6R,7S)-7-Amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 98%, Cefaclor Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7S)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 108260-07-7) is a chemical compound with the molecular formula C7H7ClN2O3S and a molecular weight of 234.66 g/mol. IUPAC name: (6R,7S)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: OQSAFIZCBAZPMY-BBIVZNJYSA-N.
| Molecular formula | C7H7ClN2O3S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | (6R,7S)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | OQSAFIZCBAZPMY-BBIVZNJYSA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@H](C2=O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)