Products 2455-92-7
CAS 2455-92-7 appears in our catalog under these names: Indapamide Impurity 2, Indapamide Impurity I, Indapamide Impurity A, Sulclamide, >95% (HPLC), 4-Chloro-3-sulfamoylbenzamide, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10g, 1g, 5g, 100mg, 250mg, 100 mg, 250 mg.
4-chloro-3-sulfamoylbenzamide (CAS 2455-92-7) is a chemical compound with the molecular formula C7H7ClN2O3S and a molecular weight of 234.66 g/mol. IUPAC name: 4-chloro-3-sulfamoylbenzamide. InChIKey: WRLKLPDTRUYBBV-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 4-chloro-3-sulfamoylbenzamide |
| InChIKey | WRLKLPDTRUYBBV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)