CAS 876715-31-0 is the registry number for (5-Chloro-1-methyl-6-oxo-1,6-dihydro-pyridazin-4-ylsulfanyl)-acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-chloro-1-methyl-6-oxopyridazin-4-yl)sulfanylacetic acid (CAS 876715-31-0) is a chemical compound with the molecular formula C7H7ClN2O3S and a molecular weight of 234.66 g/mol. IUPAC name: 2-(5-chloro-1-methyl-6-oxopyridazin-4-yl)sulfanylacetic acid. InChIKey: VIIUVGOMWCKKFL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3S |
|---|---|
| Molecular weight | 234.66 g/mol |
| IUPAC name | 2-(5-chloro-1-methyl-6-oxopyridazin-4-yl)sulfanylacetic acid |
| InChIKey | VIIUVGOMWCKKFL-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C=N1)SCC(=O)O)Cl |
Computed by PubChem (NCBI)