Products 108260-84-0

CAS 108260-84-0 is the registry number for Esmolol Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 3-[4-(2,3-dihydroxypropoxy)phenyl]propanoate (CAS 108260-84-0) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: methyl 3-[4-(2,3-dihydroxypropoxy)phenyl]propanoate. InChIKey: BJOVDFMZFATSMY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O5
Molecular weight254.28 g/mol
IUPAC namemethyl 3-[4-(2,3-dihydroxypropoxy)phenyl]propanoate
InChIKeyBJOVDFMZFATSMY-UHFFFAOYSA-N
SMILESCOC(=O)CCC1=CC=C(C=C1)OCC(CO)O

Computed by PubChem (NCBI)