Products 195202-08-5
CAS 195202-08-5 appears in our catalog under these names: (S)-2-(3,4,5-Trimethoxyphenyl)butyric Acid, >95% (HPLC), (2S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid, (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid 97%, (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid, 97%, 97%, (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid, 97%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 2,5g, 1g, 5g, 10g, 25g.
(2S)-2-(3,4,5-trimethoxyphenyl)butanoic acid (CAS 195202-08-5) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: (2S)-2-(3,4,5-trimethoxyphenyl)butanoic acid. InChIKey: WBULUDGUWZFLMO-VIFPVBQESA-N.
| Molecular formula | C13H18O5 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | (2S)-2-(3,4,5-trimethoxyphenyl)butanoic acid |
| InChIKey | WBULUDGUWZFLMO-VIFPVBQESA-N |
| SMILES | CC[C@@H](C1=CC(=C(C(=C1)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S)-2-(3,4,5-trimethoxyphenyl)butanoic acid, (S)-2-(3,4,5-Trimethoxyphenyl)butanoic acid, (S)-2-(3,4,5-Trimethoxyphenyl)butyric acid, (alphaS)-alpha-Ethyl-3,4,5-trimethoxybenzeneacetic Acid;, 2-(3,4,5-Trimethoxyphenyl)butyric acid, (S)-, (alphaS)-alpha-Ethyl-3,4,5-trimethoxybenzeneacetic acid, Benzeneacetic acid, alpha-ethyl-3,4,5-trimethoxy-, (alphaS)-