CAS 91842-53-4 appears in our catalog under these names: {2-[2-(Benzyloxy)ethoxy]ethoxy}acetic acid, 98%, Benzyl–PEG2–CH2COOH, Benzyl-PEG2-CH2COOH 95%, 2-(2-(2-(Benzyloxy)ethoxy)ethoxy)acetic acid, 95%, 95%, Benzyl-PEG2-CH2COOH, 95.0%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 100mg, 250mg, 1 g, 250 mg, 100 mg.
2-[2-(2-phenylmethoxyethoxy)ethoxy]acetic acid (CAS 91842-53-4) is a chemical compound with the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. IUPAC name: 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetic acid. InChIKey: JCPUGBBSZRZZNM-UHFFFAOYSA-N.
| Molecular formula | C13H18O5 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetic acid |
| InChIKey | JCPUGBBSZRZZNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCC(=O)O |
Computed by PubChem (NCBI)