CAS 1082837-93-1 is the registry number for 2-(6-(Ethanesulfonyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid (CAS 1082837-93-1) is a chemical compound with the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. IUPAC name: 2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid. InChIKey: ZBNGRAMQKOOTAO-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6S |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | 2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid |
| InChIKey | ZBNGRAMQKOOTAO-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC2=C(C=C1)OC(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)