Products 1082837-93-1

CAS 1082837-93-1 is the registry number for 2-(6-(Ethanesulfonyl)-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid (CAS 1082837-93-1) is a chemical compound with the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. IUPAC name: 2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid. InChIKey: ZBNGRAMQKOOTAO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO6S
Molecular weight299.30 g/mol
IUPAC name2-(6-ethylsulfonyl-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid
InChIKeyZBNGRAMQKOOTAO-UHFFFAOYSA-N
SMILESCCS(=O)(=O)C1=CC2=C(C=C1)OC(C(=O)N2)CC(=O)O

Computed by PubChem (NCBI)