CAS 300567-24-2 is the registry number for Methyl 4–((3–methoxy–3–oxopropyl)sulfanyl)–3–nitrobenzoate. Offered by: GLPBio. Available pack sizes: 250mg.
Methyl 4-(3-methoxy-3-oxopropyl)sulfanyl-3-nitrobenzoate (CAS 300567-24-2) is a chemical compound with the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. IUPAC name: methyl 4-(3-methoxy-3-oxopropyl)sulfanyl-3-nitrobenzoate. InChIKey: XYRFGRPUSVXKBF-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6S |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | methyl 4-(3-methoxy-3-oxopropyl)sulfanyl-3-nitrobenzoate |
| InChIKey | XYRFGRPUSVXKBF-UHFFFAOYSA-N |
| SMILES | COC(=O)CCSC1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)