CAS 1083168-68-6 appears in our catalog under these names: Methyl 2,3-dihydrobenzofuran-6-carboxylate, 98%, Methyl 2,3-dihydrobenzofuran-6-carboxylate, 98.95%, methyl 2,3-dihydro-1-benzofuran-6-carboxylate. Offered by: AmBeed, MedChemExpress, Fluorochem, Biosynth. Available pack sizes: 250mg, 1g, 100 mg, 25 mg, 50 mg, 100mg, 0,5g, 50mg.
Methyl 2,3-dihydro-1-benzofuran-6-carboxylate (CAS 1083168-68-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: methyl 2,3-dihydro-1-benzofuran-6-carboxylate. InChIKey: OVZHUVTYFSNMMA-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | methyl 2,3-dihydro-1-benzofuran-6-carboxylate |
| InChIKey | OVZHUVTYFSNMMA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CCO2)C=C1 |
Computed by PubChem (NCBI)