CAS 108395-15-9 appears in our catalog under these names: 2-Ketoglutaric Acid-13C1, 2–Ketoglutaric acid–13C, 2-Ketoglutaric acid-13C, 97.94%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500μg, 500 μg.
2-oxo(113C)pentanedioic acid (CAS 108395-15-9) is a chemical compound with the molecular formula C5H6O5 and a molecular weight of 147.09 g/mol. IUPAC name: 2-oxo(113C)pentanedioic acid. InChIKey: KPGXRSRHYNQIFN-HOSYLAQJSA-N.
| Molecular formula | C5H6O5 |
|---|---|
| Molecular weight | 147.09 g/mol |
| IUPAC name | 2-oxo(113C)pentanedioic acid |
| InChIKey | KPGXRSRHYNQIFN-HOSYLAQJSA-N |
| SMILES | C(CC(=O)O)C(=O)[13C](=O)O |
Computed by PubChem (NCBI)