Products 123953-28-6
CAS 123953-28-6 is the registry number for 2-Ketoglutaric acid-13C2. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2,2-dideuterio-4-oxo(4,5-13C2)pentanedioic acid (CAS 123953-28-6) is a chemical compound with the molecular formula C5H6O5 and a molecular weight of 150.10 g/mol. IUPAC name: 2,2-dideuterio-4-oxo(4,5-13C2)pentanedioic acid. InChIKey: KPGXRSRHYNQIFN-QOYFRFFQSA-N.
| Molecular formula | C5H6O5 |
|---|---|
| Molecular weight | 150.10 g/mol |
| IUPAC name | 2,2-dideuterio-4-oxo(4,5-13C2)pentanedioic acid |
| InChIKey | KPGXRSRHYNQIFN-QOYFRFFQSA-N |
| SMILES | [2H]C([2H])(C[13C](=O)[13C](=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
alpha-Ketoglutaric acid-[13C2,d2]