Products 1173021-86-7
CAS 1173021-86-7 appears in our catalog under these names: 2-Oxo-1,5-pentanedioic Acid-d6, 98 atom % D, min 98% Chemical Purity, 2–Ketoglutaric acid–d6, 2-Ketoglutaric acid-d6, 98.62%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,01g, 1mg, 5mg, 10 mg.
Dideuterio 2,2,3,3-tetradeuterio-4-oxopentanedioate (CAS 1173021-86-7) is a chemical compound with the molecular formula C5H6O5 and a molecular weight of 152.13 g/mol. IUPAC name: dideuterio 2,2,3,3-tetradeuterio-4-oxopentanedioate. InChIKey: KPGXRSRHYNQIFN-DTDGFSOZSA-N.
| Molecular formula | C5H6O5 |
|---|---|
| Molecular weight | 152.13 g/mol |
| IUPAC name | dideuterio 2,2,3,3-tetradeuterio-4-oxopentanedioate |
| InChIKey | KPGXRSRHYNQIFN-DTDGFSOZSA-N |
| SMILES | [2H]C([2H])(C(=O)C(=O)O[2H])C([2H])([2H])C(=O)O[2H] |
Computed by PubChem (NCBI)
Synonyms:
2-Oxo(~2~H_4_)pentane(~2~H_2_)dioic acid, 2-Ketoglutaric acid-d6, dideuterio 2,2,3,3-tetradeuterio-4-oxopentanedioate, 2-Oxo-1,5-pentanedioic Acid-d6, 2-Ketopentanedioic acid-d6, Pentanedioic-2,2,3,3-d4 acid-1,5-d2, 4-oxo-, orb3138555, 2-oxo(?H?)pentanedi(?H)oic acid, 2-Ketoglutaric acid-d6, 98 atom % D, 99% (CP)