CAS 108413-51-0 is the registry number for 5-(2-Fluorophenyl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(2-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 108413-51-0) is a chemical compound with the molecular formula C8H5FN2OS and a molecular weight of 196.20 g/mol. IUPAC name: 5-(2-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: SHXFULJIZLNGII-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2OS |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | SHXFULJIZLNGII-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)O2)F |
Computed by PubChem (NCBI)