CAS 203268-64-8 appears in our catalog under these names: 5-(4-Fluoro-phenyl)-(1,3,4)oxadiazole-2-thiol, 95+%, 5-(4-Fluoro-phenyl)-[1,3,4]oxadiazole-2-thiol, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g.
5-(4-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 203268-64-8) is a chemical compound with the molecular formula C8H5FN2OS and a molecular weight of 196.20 g/mol. IUPAC name: 5-(4-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: XKMWJXQWLNRDRC-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2OS |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | XKMWJXQWLNRDRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=S)O2)F |
Computed by PubChem (NCBI)