CAS 1342386-00-8 is the registry number for 3-(3-Fluorophenyl)-1,2,4-oxadiazole-5-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-fluorophenyl)-2H-1,2,4-oxadiazole-5-thione (CAS 1342386-00-8) is a chemical compound with the molecular formula C8H5FN2OS and a molecular weight of 196.20 g/mol. IUPAC name: 3-(3-fluorophenyl)-2H-1,2,4-oxadiazole-5-thione. InChIKey: KENLNKGREQWPPC-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2OS |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-2H-1,2,4-oxadiazole-5-thione |
| InChIKey | KENLNKGREQWPPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC(=S)ON2 |
Computed by PubChem (NCBI)