CAS 108446-76-0 appears in our catalog under these names: 3-(3-Biphenyl-4-yl-1-phenyl-1h-pyrazol-4-yl)-acrylic acid, 95%, 3-(3-((1,1'-Biphenyl)-4-yl)-1-phenyl-1H-pyrazol-4-yl)acrylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
(E)-3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enoic acid (CAS 108446-76-0) is a chemical compound with the molecular formula C24H18N2O2 and a molecular weight of 366.4 g/mol. IUPAC name: (E)-3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enoic acid. InChIKey: MTNAVQZPGXQKGS-FOCLMDBBSA-N.
| Molecular formula | C24H18N2O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (E)-3-[1-phenyl-3-(4-phenylphenyl)pyrazol-4-yl]prop-2-enoic acid |
| InChIKey | MTNAVQZPGXQKGS-FOCLMDBBSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NN(C=C3/C=C/C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)