CAS 150012-75-2 is the registry number for (2Z,2'Z)-2,2'-(1,4-Dihydroquinoxaline-2,3-diylidene)bis(1-phenylethanone), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(Z)-2-[3-[(Z)-2-hydroxy-2-phenylethenyl]quinoxalin-2-yl]-1-phenylethenol (CAS 150012-75-2) is a chemical compound with the molecular formula C24H18N2O2 and a molecular weight of 366.4 g/mol. IUPAC name: (Z)-2-[3-[(Z)-2-hydroxy-2-phenylethenyl]quinoxalin-2-yl]-1-phenylethenol. InChIKey: ISVBYKIJCLSXCY-MPKYGIEOSA-N.
| Molecular formula | C24H18N2O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (Z)-2-[3-[(Z)-2-hydroxy-2-phenylethenyl]quinoxalin-2-yl]-1-phenylethenol |
| InChIKey | ISVBYKIJCLSXCY-MPKYGIEOSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/C2=NC3=CC=CC=C3N=C2/C=C(\O)/C4=CC=CC=C4)/O |
Computed by PubChem (NCBI)