Products 1119449-21-6
CAS 1119449-21-6 is the registry number for 2-(2-(2,2-Diphenylacetyl)-2,3-dihydro-3-oxo-1H-inden-1-ylidene)hydrazone Formaldehyde. Offered by: TRC. Available pack sizes: 100mg.
(3Z)-2-(2,2-diphenylacetyl)-3-(methylidenehydrazinylidene)inden-1-one (CAS 1119449-21-6) is a chemical compound with the molecular formula C24H18N2O2 and a molecular weight of 366.4 g/mol. IUPAC name: (3Z)-2-(2,2-diphenylacetyl)-3-(methylidenehydrazinylidene)inden-1-one. InChIKey: WGCHXJADQZBUFT-XTCLZLMSSA-N.
| Molecular formula | C24H18N2O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (3Z)-2-(2,2-diphenylacetyl)-3-(methylidenehydrazinylidene)inden-1-one |
| InChIKey | WGCHXJADQZBUFT-XTCLZLMSSA-N |
| SMILES | C=N/N=C\1/C(C(=O)C2=CC=CC=C21)C(=O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)