Products 108483-18-7
CAS 108483-18-7 is the registry number for 2-Imino-3,3,7,7-tetramethyl-2H,3H,5H,6H,7H-imidazo(1,2-c)imidazolidin-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-imino-3,3,7,7-tetramethyl-6H-imidazo[1,5-a]imidazol-5-one (CAS 108483-18-7) is a chemical compound with the molecular formula C9H14N4O and a molecular weight of 194.23 g/mol. IUPAC name: 2-imino-3,3,7,7-tetramethyl-6H-imidazo[1,5-a]imidazol-5-one. InChIKey: MCCLKJZITFUGCJ-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-imino-3,3,7,7-tetramethyl-6H-imidazo[1,5-a]imidazol-5-one |
| InChIKey | MCCLKJZITFUGCJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=N)N=C2N1C(=O)NC2(C)C)C |
Computed by PubChem (NCBI)